C29H28F9NO5S — CID 118208012
4-[3-[3-(2,2-difluoroethyl)phenyl]sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid (PubChem CID 118208012) has the molecular formula C29H28F9NO5S and a molecular weight of 673.59 g/mol. Its IUPAC name is 4-[3-[3-(2,2-difluoroethyl)phenyl]sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[3-[3-(2,2-difluoroethyl)phenyl]sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 118208012 |
| Molecular Formula | C29H28F9NO5S |
| Molecular Weight | 673.59 g/mol |
| Exact Mass | 673.15 |
| IUPAC Name | 4-[3-[3-(2,2-difluoroethyl)phenyl]sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)N2CCC(c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3cccc(CC(F)F)c3)C2)CC1 |
| InChI | InChI=1S/C29H28F9NO5S/c30-23(31)15-17-2-1-3-22(14-17)45(43,44)26(12-13-39(16-26)24(40)18-4-6-19(7-5-18)25(41)42)20-8-10-21(11-9-20)27(32,28(33,34)35)29(36,37)38/h1-3,8-11,14,18-19,23H,4-7,12-13,15-16H2,(H,41,42) |
| InChIKey | WWQOWBJZZJVKDB-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.59 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |