C27H25F10NO3S — CID 134374196
cyclohexyl-[3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-1-yl]methanone (PubChem CID 134374196) has the molecular formula C27H25F10NO3S and a molecular weight of 633.55 g/mol. Its IUPAC name is cyclohexyl-[3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-1-yl]methanone.
| Compound Name | cyclohexyl-[3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 134374196 |
| Molecular Formula | C27H25F10NO3S |
| Molecular Weight | 633.55 g/mol |
| Exact Mass | 633.14 |
| IUPAC Name | cyclohexyl-[3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-1-yl]methanone |
| SMILES | O=C(C1CCCCC1)N1CCC(c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C27H25F10NO3S/c28-24(26(32,33)34,27(35,36)37)19-11-9-18(10-12-19)23(13-14-38(16-23)22(39)17-5-2-1-3-6-17)42(40,41)21-8-4-7-20(15-21)25(29,30)31/h4,7-12,15,17H,1-3,5-6,13-14,16H2 |
| InChIKey | GFWPEEURYLVDCS-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.55 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |