C28H28F7NO6S — CID 118217593
4-[(3R)-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-(4-methoxyphenyl)sulfonylpyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid (PubChem CID 118217593) has the molecular formula C28H28F7NO6S and a molecular weight of 639.59 g/mol. Its IUPAC name is 4-[(3R)-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-(4-methoxyphenyl)sulfonylpyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(3R)-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-(4-methoxyphenyl)sulfonylpyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 118217593 |
| Molecular Formula | C28H28F7NO6S |
| Molecular Weight | 639.59 g/mol |
| Exact Mass | 639.15 |
| IUPAC Name | 4-[(3R)-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-(4-methoxyphenyl)sulfonylpyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid |
| SMILES | COc1ccc(S(=O)(=O)[C@@]2(c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)CCN(C(=O)C3CCC(C(=O)O)CC3)C2)cc1 |
| InChI | InChI=1S/C28H28F7NO6S/c1-42-21-10-12-22(13-11-21)43(40,41)25(14-15-36(16-25)23(37)17-2-4-18(5-3-17)24(38)39)19-6-8-20(9-7-19)26(29,27(30,31)32)28(33,34)35/h6-13,17-18H,2-5,14-16H2,1H3,(H,38,39)/t17?,18?,25-/m0/s1 |
| InChIKey | PHWSECSLTQRKEH-KRFIBBNCSA-N |
| XLogP | 5.78 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.59 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |