C35H33F8NO6S — CID 118217810
4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-[1,1,1,3,3,3-hexafluoro-2-[(2-fluoro-6-methylphenyl)methoxy]propan-2-yl]phenyl]pyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid (PubChem CID 118217810) has the molecular formula C35H33F8NO6S and a molecular weight of 747.70 g/mol. Its IUPAC name is 4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-[1,1,1,3,3,3-hexafluoro-2-[(2-fluoro-6-methylphenyl)methoxy]propan-2-yl]phenyl]pyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-[1,1,1,3,3,3-hexafluoro-2-[(2-fluoro-6-methylphenyl)methoxy]propan-2-yl]phenyl]pyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 118217810 |
| Molecular Formula | C35H33F8NO6S |
| Molecular Weight | 747.70 g/mol |
| Exact Mass | 747.19 |
| IUPAC Name | 4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-[1,1,1,3,3,3-hexafluoro-2-[(2-fluoro-6-methylphenyl)methoxy]propan-2-yl]phenyl]pyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid |
| SMILES | Cc1cccc(F)c1COC(c1ccc([C@]2(S(=O)(=O)c3ccc(F)cc3)CCN(C(=O)C3CCC(C(=O)O)CC3)C2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C35H33F8NO6S/c1-21-3-2-4-29(37)28(21)19-50-33(34(38,39)40,35(41,42)43)25-11-9-24(10-12-25)32(51(48,49)27-15-13-26(36)14-16-27)17-18-44(20-32)30(45)22-5-7-23(8-6-22)31(46)47/h2-4,9-16,22-23H,5-8,17-20H2,1H3,(H,46,47)/t22?,23?,32-/m0/s1 |
| InChIKey | AEIAAWBDOUMTLX-KHZVSIKASA-N |
| XLogP | 7.60 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.70 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |