C33H29F9N2O6S — CID 118208041
1-[(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carbonyl]piperidine-4-carboxylic acid (PubChem CID 118208041) has the molecular formula C33H29F9N2O6S and a molecular weight of 752.65 g/mol. Its IUPAC name is 1-[(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carbonyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carbonyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 118208041 |
| Molecular Formula | C33H29F9N2O6S |
| Molecular Weight | 752.65 g/mol |
| Exact Mass | 752.16 |
| IUPAC Name | 1-[(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carbonyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)N2CC[C@](c3ccc(C(OCc4c(F)cccc4F)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C33H29F9N2O6S/c34-23-8-10-24(11-9-23)51(48,49)30(14-17-44(19-30)29(47)43-15-12-20(13-16-43)28(45)46)21-4-6-22(7-5-21)31(32(37,38)39,33(40,41)42)50-18-25-26(35)2-1-3-27(25)36/h1-11,20H,12-19H2,(H,45,46)/t30-/m0/s1 |
| InChIKey | NQYYIADIMIOXNG-PMERELPUSA-N |
| XLogP | 6.93 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.65 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |