C33H31F9N2O6S2 — CID 118217671
[(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]-(1-methylsulfonylpiperidin-4-yl)methanone (PubChem CID 118217671) has the molecular formula C33H31F9N2O6S2 and a molecular weight of 786.74 g/mol. Its IUPAC name is [(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]-(1-methylsulfonylpiperidin-4-yl)methanone.
| Compound Name | [(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]-(1-methylsulfonylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 118217671 |
| Molecular Formula | C33H31F9N2O6S2 |
| Molecular Weight | 786.74 g/mol |
| Exact Mass | 786.15 |
| IUPAC Name | [(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]-(1-methylsulfonylpiperidin-4-yl)methanone |
| SMILES | CS(=O)(=O)N1CCC(C(=O)N2CC[C@](c3ccc(C(OCc4c(F)cccc4F)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C33H31F9N2O6S2/c1-51(46,47)44-16-13-21(14-17-44)29(45)43-18-15-30(20-43,52(48,49)25-11-9-24(34)10-12-25)22-5-7-23(8-6-22)31(32(37,38)39,33(40,41)42)50-19-26-27(35)3-2-4-28(26)36/h2-12,21H,13-20H2,1H3/t30-/m0/s1 |
| InChIKey | PYTHKUHXIRQPET-PMERELPUSA-N |
| XLogP | 6.21 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.74 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |