C35H26F9NO6S — CID 118217688
4-[2-[(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]-2-oxoethyl]benzoic acid (PubChem CID 118217688) has the molecular formula C35H26F9NO6S and a molecular weight of 759.64 g/mol. Its IUPAC name is 4-[2-[(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]-2-oxoethyl]benzoic acid.
| Compound Name | 4-[2-[(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]-2-oxoethyl]benzoic acid |
|---|---|
| PubChem CID | 118217688 |
| Molecular Formula | C35H26F9NO6S |
| Molecular Weight | 759.64 g/mol |
| Exact Mass | 759.13 |
| IUPAC Name | 4-[2-[(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]-2-oxoethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CC(=O)N2CC[C@](c3ccc(C(OCc4c(F)cccc4F)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C35H26F9NO6S/c36-25-12-14-26(15-13-25)52(49,50)32(16-17-45(20-32)30(46)18-21-4-6-22(7-5-21)31(47)48)23-8-10-24(11-9-23)33(34(39,40)41,35(42,43)44)51-19-27-28(37)2-1-3-29(27)38/h1-15H,16-20H2,(H,47,48)/t32-/m0/s1 |
| InChIKey | OHRXGPGNTBJJOL-YTTGMZPUSA-N |
| XLogP | 7.48 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.64 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |