C33H26F9NO4S — CID 123517692
[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]-phenylmethanol (PubChem CID 123517692) has the molecular formula C33H26F9NO4S and a molecular weight of 703.62 g/mol. Its IUPAC name is [3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]-phenylmethanol.
| Compound Name | [3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]-phenylmethanol |
|---|---|
| PubChem CID | 123517692 |
| Molecular Formula | C33H26F9NO4S |
| Molecular Weight | 703.62 g/mol |
| Exact Mass | 703.14 |
| IUPAC Name | [3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]-phenylmethanol |
| SMILES | O=S(=O)(c1ccc(F)cc1)C1(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)CCN(C(O)c2ccccc2)C1 |
| InChI | InChI=1S/C33H26F9NO4S/c34-24-13-15-25(16-14-24)48(45,46)30(17-18-43(20-30)29(44)21-5-2-1-3-6-21)22-9-11-23(12-10-22)31(32(37,38)39,33(40,41)42)47-19-26-27(35)7-4-8-28(26)36/h1-16,29,44H,17-20H2 |
| InChIKey | ARPXFAZOIRJFHU-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.62 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |