C32H29F9N2O5S — CID 118217674
(4-aminooxan-4-yl)-[(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]methanone (PubChem CID 118217674) has the molecular formula C32H29F9N2O5S and a molecular weight of 724.64 g/mol. Its IUPAC name is (4-aminooxan-4-yl)-[(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]methanone.
| Compound Name | (4-aminooxan-4-yl)-[(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 118217674 |
| Molecular Formula | C32H29F9N2O5S |
| Molecular Weight | 724.64 g/mol |
| Exact Mass | 724.17 |
| IUPAC Name | (4-aminooxan-4-yl)-[(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]methanone |
| SMILES | NC1(C(=O)N2CC[C@](c3ccc(C(OCc4c(F)cccc4F)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)cc3)C2)CCOCC1 |
| InChI | InChI=1S/C32H29F9N2O5S/c33-22-8-10-23(11-9-22)49(45,46)29(12-15-43(19-29)27(44)28(42)13-16-47-17-14-28)20-4-6-21(7-5-20)30(31(36,37)38,32(39,40)41)48-18-24-25(34)2-1-3-26(24)35/h1-11H,12-19,42H2/t29-/m0/s1 |
| InChIKey | FSCCTNMQVLPYFM-LJAQVGFWSA-N |
| XLogP | 6.05 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.64 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |