C33H36F7NO6S — CID 123426013
4-[3-[4-[2-(cyclopentylmethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid (PubChem CID 123426013) has the molecular formula C33H36F7NO6S and a molecular weight of 707.71 g/mol. Its IUPAC name is 4-[3-[4-[2-(cyclopentylmethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[3-[4-[2-(cyclopentylmethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 123426013 |
| Molecular Formula | C33H36F7NO6S |
| Molecular Weight | 707.71 g/mol |
| Exact Mass | 707.22 |
| IUPAC Name | 4-[3-[4-[2-(cyclopentylmethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)N2CCC(c3ccc(C(OCC4CCCC4)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C33H36F7NO6S/c34-26-13-15-27(16-14-26)48(45,46)30(17-18-41(20-30)28(42)22-5-7-23(8-6-22)29(43)44)24-9-11-25(12-10-24)31(32(35,36)37,33(38,39)40)47-19-21-3-1-2-4-21/h9-16,21-23H,1-8,17-20H2,(H,43,44) |
| InChIKey | PLKYVCCAKOPPGQ-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.71 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |