C27H28F8N2O3S — CID 123340507
[4-(aminomethyl)cyclohexyl]-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone (PubChem CID 123340507) has the molecular formula C27H28F8N2O3S and a molecular weight of 612.58 g/mol. Its IUPAC name is [4-(aminomethyl)cyclohexyl]-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone.
| Compound Name | [4-(aminomethyl)cyclohexyl]-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 123340507 |
| Molecular Formula | C27H28F8N2O3S |
| Molecular Weight | 612.58 g/mol |
| Exact Mass | 612.17 |
| IUPAC Name | [4-(aminomethyl)cyclohexyl]-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone |
| SMILES | NCC1CCC(C(=O)N2CCC(c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C27H28F8N2O3S/c28-21-9-11-22(12-10-21)41(39,40)24(13-14-37(16-24)23(38)18-3-1-17(15-36)2-4-18)19-5-7-20(8-6-19)25(29,26(30,31)32)27(33,34)35/h5-12,17-18H,1-4,13-16,36H2 |
| InChIKey | FXWZFLDVWIUHKY-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.58 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |