C24H23F8N3O4S — CID 123803073
N-(2-acetamidoethyl)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carboxamide (PubChem CID 123803073) has the molecular formula C24H23F8N3O4S and a molecular weight of 601.52 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 123803073 |
| Molecular Formula | C24H23F8N3O4S |
| Molecular Weight | 601.52 g/mol |
| Exact Mass | 601.13 |
| IUPAC Name | N-(2-acetamidoethyl)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carboxamide |
| SMILES | CC(=O)NCCNC(=O)N1CCC(c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C24H23F8N3O4S/c1-15(36)33-11-12-34-20(37)35-13-10-21(14-35,40(38,39)19-8-6-18(25)7-9-19)16-2-4-17(5-3-16)22(26,23(27,28)29)24(30,31)32/h2-9H,10-14H2,1H3,(H,33,36)(H,34,37) |
| InChIKey | LEVWWCGYIDBZKI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|