C25H23F8NO5S — CID 118217599
[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-(4-hydroxyoxan-4-yl)methanone (PubChem CID 118217599) has the molecular formula C25H23F8NO5S and a molecular weight of 601.51 g/mol. Its IUPAC name is [(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-(4-hydroxyoxan-4-yl)methanone.
| Compound Name | [(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-(4-hydroxyoxan-4-yl)methanone |
|---|---|
| PubChem CID | 118217599 |
| Molecular Formula | C25H23F8NO5S |
| Molecular Weight | 601.51 g/mol |
| Exact Mass | 601.12 |
| IUPAC Name | [(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-(4-hydroxyoxan-4-yl)methanone |
| SMILES | O=C(N1CC[C@](c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1)C1(O)CCOCC1 |
| InChI | InChI=1S/C25H23F8NO5S/c26-18-5-7-19(8-6-18)40(37,38)22(9-12-34(15-22)20(35)21(36)10-13-39-14-11-21)16-1-3-17(4-2-16)23(27,24(28,29)30)25(31,32)33/h1-8,36H,9-15H2/t22-/m0/s1 |
| InChIKey | ZAJAIOIIRXVRGH-QFIPXVFZSA-N |
| XLogP | 4.56 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.51 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |