C29H26F9NO5S — CID 118208170
4-[(3R)-3-[3-fluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carbonyl]bicyclo[2.2.2]octane-1-carboxylic acid (PubChem CID 118208170) has the molecular formula C29H26F9NO5S and a molecular weight of 671.58 g/mol. Its IUPAC name is 4-[(3R)-3-[3-fluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carbonyl]bicyclo[2.2.2]octane-1-carboxylic acid.
| Compound Name | 4-[(3R)-3-[3-fluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carbonyl]bicyclo[2.2.2]octane-1-carboxylic acid |
|---|---|
| PubChem CID | 118208170 |
| Molecular Formula | C29H26F9NO5S |
| Molecular Weight | 671.58 g/mol |
| Exact Mass | 671.14 |
| IUPAC Name | 4-[(3R)-3-[3-fluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carbonyl]bicyclo[2.2.2]octane-1-carboxylic acid |
| SMILES | O=C(O)C12CCC(C(=O)N3CC[C@](c4ccc(C(F)(C(F)(F)F)C(F)(F)F)c(F)c4)(S(=O)(=O)c4ccc(F)cc4)C3)(CC1)CC2 |
| InChI | InChI=1S/C29H26F9NO5S/c30-18-2-4-19(5-3-18)45(43,44)26(17-1-6-20(21(31)15-17)27(32,28(33,34)35)29(36,37)38)13-14-39(16-26)22(40)24-7-10-25(11-8-24,12-9-24)23(41)42/h1-6,15H,7-14,16H2,(H,41,42)/t24?,25?,26-/m0/s1 |
| InChIKey | AJLOMLHFEUJYPV-WNMGUVTHSA-N |
| XLogP | 6.58 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.58 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |