C29H27F8NO6S — CID 118217850
4-[(3R)-3-(4-fluoro-3-methylphenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-2-oxabicyclo[2.2.2]octane-1-carboxylic acid (PubChem CID 118217850) has the molecular formula C29H27F8NO6S and a molecular weight of 669.59 g/mol. Its IUPAC name is 4-[(3R)-3-(4-fluoro-3-methylphenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-2-oxabicyclo[2.2.2]octane-1-carboxylic acid.
| Compound Name | 4-[(3R)-3-(4-fluoro-3-methylphenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-2-oxabicyclo[2.2.2]octane-1-carboxylic acid |
|---|---|
| PubChem CID | 118217850 |
| Molecular Formula | C29H27F8NO6S |
| Molecular Weight | 669.59 g/mol |
| Exact Mass | 669.14 |
| IUPAC Name | 4-[(3R)-3-(4-fluoro-3-methylphenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-2-oxabicyclo[2.2.2]octane-1-carboxylic acid |
| SMILES | Cc1cc(S(=O)(=O)[C@@]2(c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)CCN(C(=O)C34CCC(C(=O)O)(CC3)OC4)C2)ccc1F |
| InChI | InChI=1S/C29H27F8NO6S/c1-17-14-20(6-7-21(17)30)45(42,43)26(18-2-4-19(5-3-18)27(31,28(32,33)34)29(35,36)37)12-13-38(15-26)22(39)24-8-10-25(11-9-24,23(40)41)44-16-24/h2-7,14H,8-13,15-16H2,1H3,(H,40,41)/t24?,25?,26-/m0/s1 |
| InChIKey | LJRBSKVLWJILQM-WNMGUVTHSA-N |
| XLogP | 5.74 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.59 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |