C30H29F8NO5S — CID 118217848
4-[(3R)-3-(4-fluoro-3-methylphenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]bicyclo[2.2.2]octane-1-carboxylic acid (PubChem CID 118217848) has the molecular formula C30H29F8NO5S and a molecular weight of 667.62 g/mol. Its IUPAC name is 4-[(3R)-3-(4-fluoro-3-methylphenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]bicyclo[2.2.2]octane-1-carboxylic acid.
| Compound Name | 4-[(3R)-3-(4-fluoro-3-methylphenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]bicyclo[2.2.2]octane-1-carboxylic acid |
|---|---|
| PubChem CID | 118217848 |
| Molecular Formula | C30H29F8NO5S |
| Molecular Weight | 667.62 g/mol |
| Exact Mass | 667.16 |
| IUPAC Name | 4-[(3R)-3-(4-fluoro-3-methylphenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]bicyclo[2.2.2]octane-1-carboxylic acid |
| SMILES | Cc1cc(S(=O)(=O)[C@@]2(c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)CCN(C(=O)C34CCC(C(=O)O)(CC3)CC4)C2)ccc1F |
| InChI | InChI=1S/C30H29F8NO5S/c1-18-16-21(6-7-22(18)31)45(43,44)27(19-2-4-20(5-3-19)28(32,29(33,34)35)30(36,37)38)14-15-39(17-27)23(40)25-8-11-26(12-9-25,13-10-25)24(41)42/h2-7,16H,8-15,17H2,1H3,(H,41,42)/t25?,26?,27-/m0/s1 |
| InChIKey | IQRYBXXXVMYQFI-RCSZBHJWSA-N |
| XLogP | 6.75 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.62 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |