C32H33F8NO5S — CID 166668761
4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-propylphenyl]pyrrolidine-1-carbonyl]bicyclo[2.2.2]octane-1-carboxylic acid (PubChem CID 166668761) has the molecular formula C32H33F8NO5S and a molecular weight of 695.67 g/mol. Its IUPAC name is 4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-propylphenyl]pyrrolidine-1-carbonyl]bicyclo[2.2.2]octane-1-carboxylic acid.
| Compound Name | 4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-propylphenyl]pyrrolidine-1-carbonyl]bicyclo[2.2.2]octane-1-carboxylic acid |
|---|---|
| PubChem CID | 166668761 |
| Molecular Formula | C32H33F8NO5S |
| Molecular Weight | 695.67 g/mol |
| Exact Mass | 695.20 |
| IUPAC Name | 4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-propylphenyl]pyrrolidine-1-carbonyl]bicyclo[2.2.2]octane-1-carboxylic acid |
| SMILES | CCCc1cc(C(F)(C(F)(F)F)C(F)(F)F)ccc1[C@]1(S(=O)(=O)c2ccc(F)cc2)CCN(C(=O)C23CCC(C(=O)O)(CC2)CC3)C1 |
| InChI | InChI=1S/C32H33F8NO5S/c1-2-3-20-18-21(30(34,31(35,36)37)32(38,39)40)4-9-24(20)29(47(45,46)23-7-5-22(33)6-8-23)16-17-41(19-29)25(42)27-10-13-28(14-11-27,15-12-27)26(43)44/h4-9,18H,2-3,10-17,19H2,1H3,(H,43,44)/t27?,28?,29-/m0/s1 |
| InChIKey | HDVZMFRLIPPSCV-PPUMFKDSSA-N |
| XLogP | 7.39 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.67 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |