C29H31F8NO5S — CID 134374387
[(3R)-3-[4-(2-ethoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)-3-fluorophenyl]-3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]-[4-(hydroxymethyl)cyclohexyl]methanone (PubChem CID 134374387) has the molecular formula C29H31F8NO5S and a molecular weight of 657.62 g/mol. Its IUPAC name is [(3R)-3-[4-(2-ethoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)-3-fluorophenyl]-3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]-[4-(hydroxymethyl)cyclohexyl]methanone.
| Compound Name | [(3R)-3-[4-(2-ethoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)-3-fluorophenyl]-3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]-[4-(hydroxymethyl)cyclohexyl]methanone |
|---|---|
| PubChem CID | 134374387 |
| Molecular Formula | C29H31F8NO5S |
| Molecular Weight | 657.62 g/mol |
| Exact Mass | 657.18 |
| IUPAC Name | [(3R)-3-[4-(2-ethoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)-3-fluorophenyl]-3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]-[4-(hydroxymethyl)cyclohexyl]methanone |
| SMILES | CCOC(c1ccc([C@]2(S(=O)(=O)c3ccc(F)cc3)CCN(C(=O)C3CCC(CO)CC3)C2)cc1F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C29H31F8NO5S/c1-2-43-27(28(32,33)34,29(35,36)37)23-12-7-20(15-24(23)31)26(44(41,42)22-10-8-21(30)9-11-22)13-14-38(17-26)25(40)19-5-3-18(16-39)4-6-19/h7-12,15,18-19,39H,2-6,13-14,16-17H2,1H3/t18?,19?,26-/m0/s1 |
| InChIKey | UCADMXVNERWMKJ-CPHAMLGRSA-N |
| XLogP | 6.02 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.62 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |