C28H29F8NO3S — CID 134374390
cyclohexyl-[(3R)-3-[4-(2-ethoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)-3-fluorophenyl]-3-(4-fluorophenyl)sulfinylpyrrolidin-1-yl]methanone (PubChem CID 134374390) has the molecular formula C28H29F8NO3S and a molecular weight of 611.60 g/mol. Its IUPAC name is cyclohexyl-[(3R)-3-[4-(2-ethoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)-3-fluorophenyl]-3-(4-fluorophenyl)sulfinylpyrrolidin-1-yl]methanone.
| Compound Name | cyclohexyl-[(3R)-3-[4-(2-ethoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)-3-fluorophenyl]-3-(4-fluorophenyl)sulfinylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 134374390 |
| Molecular Formula | C28H29F8NO3S |
| Molecular Weight | 611.60 g/mol |
| Exact Mass | 611.17 |
| IUPAC Name | cyclohexyl-[(3R)-3-[4-(2-ethoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)-3-fluorophenyl]-3-(4-fluorophenyl)sulfinylpyrrolidin-1-yl]methanone |
| SMILES | CCOC(c1ccc([C@]2(S(=O)c3ccc(F)cc3)CCN(C(=O)C3CCCCC3)C2)cc1F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C28H29F8NO3S/c1-2-40-26(27(31,32)33,28(34,35)36)22-13-8-19(16-23(22)30)25(41(39)21-11-9-20(29)10-12-21)14-15-37(17-25)24(38)18-6-4-3-5-7-18/h8-13,16,18H,2-7,14-15,17H2,1H3/t25-,41?/m0/s1 |
| InChIKey | FSHYAJDJBPULCL-LZBJMVSRSA-N |
| XLogP | 7.14 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.60 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |