C20H17F8NO3S — CID 118207930
(3R)-3-[3-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine (PubChem CID 118207930) has the molecular formula C20H17F8NO3S and a molecular weight of 503.41 g/mol. Its IUPAC name is (3R)-3-[3-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine.
| Compound Name | (3R)-3-[3-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 118207930 |
| Molecular Formula | C20H17F8NO3S |
| Molecular Weight | 503.41 g/mol |
| Exact Mass | 503.08 |
| IUPAC Name | (3R)-3-[3-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine |
| SMILES | COC(c1ccc([C@]2(S(=O)(=O)c3ccc(F)cc3)CCNC2)cc1F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H17F8NO3S/c1-32-18(19(23,24)25,20(26,27)28)15-7-2-12(10-16(15)22)17(8-9-29-11-17)33(30,31)14-5-3-13(21)4-6-14/h2-7,10,29H,8-9,11H2,1H3/t17-/m0/s1 |
| InChIKey | RITKEVLTOXQVTH-KRWDZBQOSA-N |
| XLogP | 4.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |