C20H15F10NO2S — CID 118207997
3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidine (PubChem CID 118207997) has the molecular formula C20H15F10NO2S and a molecular weight of 523.39 g/mol. Its IUPAC name is 3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidine.
| Compound Name | 3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidine |
|---|---|
| PubChem CID | 118207997 |
| Molecular Formula | C20H15F10NO2S |
| Molecular Weight | 523.39 g/mol |
| Exact Mass | 523.07 |
| IUPAC Name | 3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidine |
| SMILES | O=S(=O)(c1cccc(C(F)(F)F)c1)C1(c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)CCNC1 |
| InChI | InChI=1S/C20H15F10NO2S/c21-17(19(25,26)27,20(28,29)30)13-6-4-12(5-7-13)16(8-9-31-11-16)34(32,33)15-3-1-2-14(10-15)18(22,23)24/h1-7,10,31H,8-9,11H2 |
| InChIKey | LCXXZHHNKDOCLK-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.39 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |