C19H17F5O2S — CID 150543071
1-[1-(benzenesulfonyl)cyclopentyl]-4-(1,1,2,2,2-pentafluoroethyl)benzene (PubChem CID 150543071) has the molecular formula C19H17F5O2S and a molecular weight of 404.40 g/mol. Its IUPAC name is 1-[1-(benzenesulfonyl)cyclopentyl]-4-(1,1,2,2,2-pentafluoroethyl)benzene.
| Compound Name | 1-[1-(benzenesulfonyl)cyclopentyl]-4-(1,1,2,2,2-pentafluoroethyl)benzene |
|---|---|
| PubChem CID | 150543071 |
| Molecular Formula | C19H17F5O2S |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 1-[1-(benzenesulfonyl)cyclopentyl]-4-(1,1,2,2,2-pentafluoroethyl)benzene |
| SMILES | O=S(=O)(c1ccccc1)C1(c2ccc(C(F)(F)C(F)(F)F)cc2)CCCC1 |
| InChI | InChI=1S/C19H17F5O2S/c20-18(21,19(22,23)24)15-10-8-14(9-11-15)17(12-4-5-13-17)27(25,26)16-6-2-1-3-7-16/h1-3,6-11H,4-5,12-13H2 |
| InChIKey | IGHHMEGMSBOALL-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|