C22H21F8NO2S — CID 118209359
4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-1-methylcyclohexan-1-amine (PubChem CID 118209359) has the molecular formula C22H21F8NO2S and a molecular weight of 515.47 g/mol. Its IUPAC name is 4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-1-methylcyclohexan-1-amine.
| Compound Name | 4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-1-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 118209359 |
| Molecular Formula | C22H21F8NO2S |
| Molecular Weight | 515.47 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | 4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-1-methylcyclohexan-1-amine |
| SMILES | CC1(N)CCC(c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H21F8NO2S/c1-18(31)10-12-19(13-11-18,34(32,33)17-8-6-16(23)7-9-17)14-2-4-15(5-3-14)20(24,21(25,26)27)22(28,29)30/h2-9H,10-13,31H2,1H3 |
| InChIKey | VTBDVJPLSQXBOV-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.47 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |