C26H21F8N3O3S — CID 118218913
N-[4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]cyclohexyl]pyrimidine-5-carboxamide (PubChem CID 118218913) has the molecular formula C26H21F8N3O3S and a molecular weight of 607.52 g/mol. Its IUPAC name is N-[4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]cyclohexyl]pyrimidine-5-carboxamide.
| Compound Name | N-[4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]cyclohexyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 118218913 |
| Molecular Formula | C26H21F8N3O3S |
| Molecular Weight | 607.52 g/mol |
| Exact Mass | 607.12 |
| IUPAC Name | N-[4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]cyclohexyl]pyrimidine-5-carboxamide |
| SMILES | O=C(NC1CCC(c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)CC1)c1cncnc1 |
| InChI | InChI=1S/C26H21F8N3O3S/c27-19-5-7-21(8-6-19)41(39,40)23(11-9-20(10-12-23)37-22(38)16-13-35-15-36-14-16)17-1-3-18(4-2-17)24(28,25(29,30)31)26(32,33)34/h1-8,13-15,20H,9-12H2,(H,37,38) |
| InChIKey | YLWXRIPZLYLZSV-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.52 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |