C28H24F8N2O3S — CID 123896223
N-[4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-2-methylcyclohexyl]pyridine-3-carboxamide (PubChem CID 123896223) has the molecular formula C28H24F8N2O3S and a molecular weight of 620.56 g/mol. Its IUPAC name is N-[4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-2-methylcyclohexyl]pyridine-3-carboxamide.
| Compound Name | N-[4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-2-methylcyclohexyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 123896223 |
| Molecular Formula | C28H24F8N2O3S |
| Molecular Weight | 620.56 g/mol |
| Exact Mass | 620.14 |
| IUPAC Name | N-[4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-2-methylcyclohexyl]pyridine-3-carboxamide |
| SMILES | CC1CC(c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)CCC1NC(=O)c1cccnc1 |
| InChI | InChI=1S/C28H24F8N2O3S/c1-17-15-25(42(40,41)22-10-8-21(29)9-11-22,13-12-23(17)38-24(39)18-3-2-14-37-16-18)19-4-6-20(7-5-19)26(30,27(31,32)33)28(34,35)36/h2-11,14,16-17,23H,12-13,15H2,1H3,(H,38,39) |
| InChIKey | UFQXHYFEIGMGHH-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.56 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |