C28H29F8NO4S — CID 118218929
4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-N-(oxan-4-ylmethyl)cyclohexane-1-carboxamide (PubChem CID 118218929) has the molecular formula C28H29F8NO4S and a molecular weight of 627.59 g/mol. Its IUPAC name is 4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-N-(oxan-4-ylmethyl)cyclohexane-1-carboxamide.
| Compound Name | 4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-N-(oxan-4-ylmethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 118218929 |
| Molecular Formula | C28H29F8NO4S |
| Molecular Weight | 627.59 g/mol |
| Exact Mass | 627.17 |
| IUPAC Name | 4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-N-(oxan-4-ylmethyl)cyclohexane-1-carboxamide |
| SMILES | O=C(NCC1CCOCC1)C1CCC(c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H29F8NO4S/c29-22-5-7-23(8-6-22)42(39,40)25(13-9-19(10-14-25)24(38)37-17-18-11-15-41-16-12-18)20-1-3-21(4-2-20)26(30,27(31,32)33)28(34,35)36/h1-8,18-19H,9-17H2,(H,37,38) |
| InChIKey | DJFIOFIWIPJDSX-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.59 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |