C33H29F9O5S — CID 158947167
2-[4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonylcyclohexyl]-1-(1-hydroxycyclopropyl)ethanone (PubChem CID 158947167) has the molecular formula C33H29F9O5S and a molecular weight of 708.64 g/mol. Its IUPAC name is 2-[4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonylcyclohexyl]-1-(1-hydroxycyclopropyl)ethanone.
| Compound Name | 2-[4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonylcyclohexyl]-1-(1-hydroxycyclopropyl)ethanone |
|---|---|
| PubChem CID | 158947167 |
| Molecular Formula | C33H29F9O5S |
| Molecular Weight | 708.64 g/mol |
| Exact Mass | 708.16 |
| IUPAC Name | 2-[4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonylcyclohexyl]-1-(1-hydroxycyclopropyl)ethanone |
| SMILES | O=C(CC1CCC(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)CC1)C1(O)CC1 |
| InChI | InChI=1S/C33H29F9O5S/c34-23-8-10-24(11-9-23)48(45,46)30(14-12-20(13-15-30)18-28(43)29(44)16-17-29)21-4-6-22(7-5-21)31(32(37,38)39,33(40,41)42)47-19-25-26(35)2-1-3-27(25)36/h1-11,20,44H,12-19H2 |
| InChIKey | JKYSVFZFGMYIFM-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.64 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |