C26H19F9O4S — CID 118220810
[(1R,2S)-2-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2-(4-fluorophenyl)sulfonylcyclopropyl]methanol (PubChem CID 118220810) has the molecular formula C26H19F9O4S and a molecular weight of 598.48 g/mol. Its IUPAC name is [(1R,2S)-2-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2-(4-fluorophenyl)sulfonylcyclopropyl]methanol.
| Compound Name | [(1R,2S)-2-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2-(4-fluorophenyl)sulfonylcyclopropyl]methanol |
|---|---|
| PubChem CID | 118220810 |
| Molecular Formula | C26H19F9O4S |
| Molecular Weight | 598.48 g/mol |
| Exact Mass | 598.09 |
| IUPAC Name | [(1R,2S)-2-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2-(4-fluorophenyl)sulfonylcyclopropyl]methanol |
| SMILES | O=S(=O)(c1ccc(F)cc1)[C@@]1(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)C[C@@H]1CO |
| InChI | InChI=1S/C26H19F9O4S/c27-18-8-10-19(11-9-18)40(37,38)23(12-17(23)13-36)15-4-6-16(7-5-15)24(25(30,31)32,26(33,34)35)39-14-20-21(28)2-1-3-22(20)29/h1-11,17,36H,12-14H2/t17-,23-/m1/s1 |
| InChIKey | UTSGRFIAMLIKRN-UZUQRXQVSA-N |
| XLogP | 6.32 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.48 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |