C32H27F9N2O5S — CID 118220834
N-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylcyclobutyl]-1-methyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 118220834) has the molecular formula C32H27F9N2O5S and a molecular weight of 722.63 g/mol. Its IUPAC name is N-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylcyclobutyl]-1-methyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylcyclobutyl]-1-methyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 118220834 |
| Molecular Formula | C32H27F9N2O5S |
| Molecular Weight | 722.63 g/mol |
| Exact Mass | 722.15 |
| IUPAC Name | N-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylcyclobutyl]-1-methyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | CN1CC(C(=O)NC2CC(c3ccc(C(OCc4c(F)cccc4F)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)cc3)C2)CC1=O |
| InChI | InChI=1S/C32H27F9N2O5S/c1-43-16-18(13-27(43)44)28(45)42-22-14-29(15-22,49(46,47)23-11-9-21(33)10-12-23)19-5-7-20(8-6-19)30(31(36,37)38,32(39,40)41)48-17-24-25(34)3-2-4-26(24)35/h2-12,18,22H,13-17H2,1H3,(H,42,45) |
| InChIKey | ZCJRNFBUGUHURF-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.63 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |