C35H33F9N2O3S — CID 144882115
1-acetyl-N-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfanylcyclopentyl]piperidine-4-carboxamide (PubChem CID 144882115) has the molecular formula C35H33F9N2O3S and a molecular weight of 732.71 g/mol. Its IUPAC name is 1-acetyl-N-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfanylcyclopentyl]piperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfanylcyclopentyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 144882115 |
| Molecular Formula | C35H33F9N2O3S |
| Molecular Weight | 732.71 g/mol |
| Exact Mass | 732.21 |
| IUPAC Name | 1-acetyl-N-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfanylcyclopentyl]piperidine-4-carboxamide |
| SMILES | CC(=O)N1CCC(C(=O)NC2CCC(Sc3ccc(F)cc3)(c3ccc(C(OCc4c(F)cccc4F)(C(F)(F)F)C(F)(F)F)cc3)C2)CC1 |
| InChI | InChI=1S/C35H33F9N2O3S/c1-21(47)46-17-14-22(15-18-46)31(48)45-26-13-16-32(19-26,50-27-11-9-25(36)10-12-27)23-5-7-24(8-6-23)33(34(39,40)41,35(42,43)44)49-20-28-29(37)3-2-4-30(28)38/h2-12,22,26H,13-20H2,1H3,(H,45,48) |
| InChIKey | VYJKQFQSTLUIKK-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.71 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |