C34H27F9N2O4S — CID 118209345
N-[4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonylcyclohexyl]pyridine-4-carboxamide (PubChem CID 118209345) has the molecular formula C34H27F9N2O4S and a molecular weight of 730.65 g/mol. Its IUPAC name is N-[4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonylcyclohexyl]pyridine-4-carboxamide.
| Compound Name | N-[4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonylcyclohexyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 118209345 |
| Molecular Formula | C34H27F9N2O4S |
| Molecular Weight | 730.65 g/mol |
| Exact Mass | 730.15 |
| IUPAC Name | N-[4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonylcyclohexyl]pyridine-4-carboxamide |
| SMILES | O=C(NC1CCC(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)CC1)c1ccncc1 |
| InChI | InChI=1S/C34H27F9N2O4S/c35-24-8-10-26(11-9-24)50(47,48)31(16-12-25(13-17-31)45-30(46)21-14-18-44-19-15-21)22-4-6-23(7-5-22)32(33(38,39)40,34(41,42)43)49-20-27-28(36)2-1-3-29(27)37/h1-11,14-15,18-19,25H,12-13,16-17,20H2,(H,45,46) |
| InChIKey | MWWPHCCWNOYTGV-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.65 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |