C34H24F9N3O3S — CID 118209385
5-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-5-(4-fluorophenyl)sulfonyl-1-pyridin-4-yl-6,7-dihydro-4H-indazole (PubChem CID 118209385) has the molecular formula C34H24F9N3O3S and a molecular weight of 725.63 g/mol. Its IUPAC name is 5-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-5-(4-fluorophenyl)sulfonyl-1-pyridin-4-yl-6,7-dihydro-4H-indazole.
| Compound Name | 5-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-5-(4-fluorophenyl)sulfonyl-1-pyridin-4-yl-6,7-dihydro-4H-indazole |
|---|---|
| PubChem CID | 118209385 |
| Molecular Formula | C34H24F9N3O3S |
| Molecular Weight | 725.63 g/mol |
| Exact Mass | 725.14 |
| IUPAC Name | 5-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-5-(4-fluorophenyl)sulfonyl-1-pyridin-4-yl-6,7-dihydro-4H-indazole |
| SMILES | O=S(=O)(c1ccc(F)cc1)C1(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)CCc2c(cnn2-c2ccncc2)C1 |
| InChI | InChI=1S/C34H24F9N3O3S/c35-24-8-10-26(11-9-24)50(47,48)31(15-12-30-21(18-31)19-45-46(30)25-13-16-44-17-14-25)22-4-6-23(7-5-22)32(33(38,39)40,34(41,42)43)49-20-27-28(36)2-1-3-29(27)37/h1-11,13-14,16-17,19H,12,15,18,20H2 |
| InChIKey | WVKUNTPCQXMGED-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.63 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |