C33H26F9NO3S — CID 118220796
N-benzyl-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylcyclobutan-1-amine (PubChem CID 118220796) has the molecular formula C33H26F9NO3S and a molecular weight of 687.62 g/mol. Its IUPAC name is N-benzyl-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylcyclobutan-1-amine.
| Compound Name | N-benzyl-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylcyclobutan-1-amine |
|---|---|
| PubChem CID | 118220796 |
| Molecular Formula | C33H26F9NO3S |
| Molecular Weight | 687.62 g/mol |
| Exact Mass | 687.15 |
| IUPAC Name | N-benzyl-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylcyclobutan-1-amine |
| SMILES | O=S(=O)(c1ccc(F)cc1)C1(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)CC(NCc2ccccc2)C1 |
| InChI | InChI=1S/C33H26F9NO3S/c34-24-13-15-26(16-14-24)47(44,45)30(17-25(18-30)43-19-21-5-2-1-3-6-21)22-9-11-23(12-10-22)31(32(37,38)39,33(40,41)42)46-20-27-28(35)7-4-8-29(27)36/h1-16,25,43H,17-20H2 |
| InChIKey | LWPHDVOBDNRQDV-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.62 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |