C27H22F7NO5S — CID 122669301
[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-phenylmethoxypropan-2-yl)phenyl]cyclobutyl]carbamic acid (PubChem CID 122669301) has the molecular formula C27H22F7NO5S and a molecular weight of 605.53 g/mol. Its IUPAC name is [3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-phenylmethoxypropan-2-yl)phenyl]cyclobutyl]carbamic acid.
| Compound Name | [3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-phenylmethoxypropan-2-yl)phenyl]cyclobutyl]carbamic acid |
|---|---|
| PubChem CID | 122669301 |
| Molecular Formula | C27H22F7NO5S |
| Molecular Weight | 605.53 g/mol |
| Exact Mass | 605.11 |
| IUPAC Name | [3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-phenylmethoxypropan-2-yl)phenyl]cyclobutyl]carbamic acid |
| SMILES | O=C(O)NC1CC(c2ccc(C(OCc3ccccc3)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C27H22F7NO5S/c28-20-10-12-22(13-11-20)41(38,39)24(14-21(15-24)35-23(36)37)18-6-8-19(9-7-18)25(26(29,30)31,27(32,33)34)40-16-17-4-2-1-3-5-17/h1-13,21,35H,14-16H2,(H,36,37) |
| InChIKey | NBQXIMUSFVCDGZ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.53 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |