C28H23BrF6O4S — CID 123643816
4-(benzenesulfonyl)-2-bromo-4-[4-(1,1,1,3,3,3-hexafluoro-2-phenylmethoxypropan-2-yl)phenyl]cyclohexan-1-one (PubChem CID 123643816) has the molecular formula C28H23BrF6O4S and a molecular weight of 649.45 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-2-bromo-4-[4-(1,1,1,3,3,3-hexafluoro-2-phenylmethoxypropan-2-yl)phenyl]cyclohexan-1-one.
| Compound Name | 4-(benzenesulfonyl)-2-bromo-4-[4-(1,1,1,3,3,3-hexafluoro-2-phenylmethoxypropan-2-yl)phenyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 123643816 |
| Molecular Formula | C28H23BrF6O4S |
| Molecular Weight | 649.45 g/mol |
| Exact Mass | 648.04 |
| IUPAC Name | 4-(benzenesulfonyl)-2-bromo-4-[4-(1,1,1,3,3,3-hexafluoro-2-phenylmethoxypropan-2-yl)phenyl]cyclohexan-1-one |
| SMILES | O=C1CCC(c2ccc(C(OCc3ccccc3)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccccc2)CC1Br |
| InChI | InChI=1S/C28H23BrF6O4S/c29-23-17-25(16-15-24(23)36,40(37,38)22-9-5-2-6-10-22)20-11-13-21(14-12-20)26(27(30,31)32,28(33,34)35)39-18-19-7-3-1-4-8-19/h1-14,23H,15-18H2 |
| InChIKey | OGFODIHKYWPTOL-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.45 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|