C27H28F6O5S — CID 130230337
tert-butyl 5-(benzenesulfonyl)-5-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)phenyl]-2-oxocyclohexane-1-carboxylate (PubChem CID 130230337) has the molecular formula C27H28F6O5S and a molecular weight of 578.57 g/mol. Its IUPAC name is tert-butyl 5-(benzenesulfonyl)-5-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)phenyl]-2-oxocyclohexane-1-carboxylate.
| Compound Name | tert-butyl 5-(benzenesulfonyl)-5-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)phenyl]-2-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 130230337 |
| Molecular Formula | C27H28F6O5S |
| Molecular Weight | 578.57 g/mol |
| Exact Mass | 578.16 |
| IUPAC Name | tert-butyl 5-(benzenesulfonyl)-5-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)phenyl]-2-oxocyclohexane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CC(c2ccc(C(C)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccccc2)CCC1=O |
| InChI | InChI=1S/C27H28F6O5S/c1-23(2,3)38-22(35)20-16-25(15-14-21(20)34,39(36,37)19-8-6-5-7-9-19)18-12-10-17(11-13-18)24(4,26(28,29)30)27(31,32)33/h5-13,20H,14-16H2,1-4H3 |
| InChIKey | IDJPYEMGVPIWNI-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.57 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|