C23H20F8O4S — CID 118209389
methyl 4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]cyclohexane-1-carboxylate (PubChem CID 118209389) has the molecular formula C23H20F8O4S and a molecular weight of 544.46 g/mol. Its IUPAC name is methyl 4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 118209389 |
| Molecular Formula | C23H20F8O4S |
| Molecular Weight | 544.46 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | methyl 4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H20F8O4S/c1-35-19(32)14-10-12-20(13-11-14,36(33,34)18-8-6-17(24)7-9-18)15-2-4-16(5-3-15)21(25,22(26,27)28)23(29,30)31/h2-9,14H,10-13H2,1H3 |
| InChIKey | GKHJFEGGZFNRJD-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.46 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |