C25H22F8O4S — CID 134491597
ethyl (3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxylate (PubChem CID 134491597) has the molecular formula C25H22F8O4S and a molecular weight of 570.50 g/mol. Its IUPAC name is ethyl (3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxylate.
| Compound Name | ethyl (3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxylate |
|---|---|
| PubChem CID | 134491597 |
| Molecular Formula | C25H22F8O4S |
| Molecular Weight | 570.50 g/mol |
| Exact Mass | 570.11 |
| IUPAC Name | ethyl (3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C25H22F8O4S/c1-2-37-21(34)18-11-12-22(38(35,36)17-7-5-16(26)6-8-17)19-10-4-15(13-14(19)3-9-20(18)22)23(27,24(28,29)30)25(31,32)33/h4-8,10,13,18,20H,2-3,9,11-12H2,1H3/t18-,20+,22-/m1/s1 |
| InChIKey | OOXYSQKNWMKEJL-KAGYGMCKSA-N |
| XLogP | 6.32 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.50 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |