C25H25F5O4S — CID 134488237
ethyl (3S,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxylate (PubChem CID 134488237) has the molecular formula C25H25F5O4S and a molecular weight of 516.53 g/mol. Its IUPAC name is ethyl (3S,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxylate.
| Compound Name | ethyl (3S,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxylate |
|---|---|
| PubChem CID | 134488237 |
| Molecular Formula | C25H25F5O4S |
| Molecular Weight | 516.53 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | ethyl (3S,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(C)(F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C25H25F5O4S/c1-3-34-22(31)19-12-13-24(35(32,33)18-8-6-17(26)7-9-18)20-11-5-16(23(2,27)25(28,29)30)14-15(20)4-10-21(19)24/h5-9,11,14,19,21H,3-4,10,12-13H2,1-2H3/t19-,21-,23?,24+/m0/s1 |
| InChIKey | KENMKZQUQUYNIW-BHDTVSORSA-N |
| XLogP | 5.78 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.53 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |