C24H21FO6S2 — CID 54577206
methyl (3R)-4,4-bis(benzenesulfonyl)-4-fluoro-2-methylidene-3-phenylbutanoate (PubChem CID 54577206) has the molecular formula C24H21FO6S2 and a molecular weight of 488.56 g/mol. Its IUPAC name is methyl (3R)-4,4-bis(benzenesulfonyl)-4-fluoro-2-methylidene-3-phenylbutanoate.
| Compound Name | methyl (3R)-4,4-bis(benzenesulfonyl)-4-fluoro-2-methylidene-3-phenylbutanoate |
|---|---|
| PubChem CID | 54577206 |
| Molecular Formula | C24H21FO6S2 |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | methyl (3R)-4,4-bis(benzenesulfonyl)-4-fluoro-2-methylidene-3-phenylbutanoate |
| SMILES | C=C(C(=O)OC)[C@@H](c1ccccc1)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H21FO6S2/c1-18(23(26)31-2)22(19-12-6-3-7-13-19)24(25,32(27,28)20-14-8-4-9-15-20)33(29,30)21-16-10-5-11-17-21/h3-17,22H,1H2,2H3/t22-/m0/s1 |
| InChIKey | FTXUGVRYERPDOS-QFIPXVFZSA-N |
| XLogP | 4.07 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|