C35H30F9NO3S — CID 144882196
3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonyl-N-[(4-methylphenyl)methyl]cyclopentan-1-amine (PubChem CID 144882196) has the molecular formula C35H30F9NO3S and a molecular weight of 715.68 g/mol. Its IUPAC name is 3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonyl-N-[(4-methylphenyl)methyl]cyclopentan-1-amine.
| Compound Name | 3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonyl-N-[(4-methylphenyl)methyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 144882196 |
| Molecular Formula | C35H30F9NO3S |
| Molecular Weight | 715.68 g/mol |
| Exact Mass | 715.18 |
| IUPAC Name | 3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonyl-N-[(4-methylphenyl)methyl]cyclopentan-1-amine |
| SMILES | Cc1ccc(CNC2CCC(c3ccc(C(OCc4c(F)cccc4F)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C35H30F9NO3S/c1-22-5-7-23(8-6-22)20-45-27-17-18-32(19-27,49(46,47)28-15-13-26(36)14-16-28)24-9-11-25(12-10-24)33(34(39,40)41,35(42,43)44)48-21-29-30(37)3-2-4-31(29)38/h2-16,27,45H,17-21H2,1H3 |
| InChIKey | GFDARZAFRFHQRO-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.68 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |