C26H24F7NO5S — CID 123681188
3-[4-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylcyclopentan-1-ol (PubChem CID 123681188) has the molecular formula C26H24F7NO5S and a molecular weight of 595.53 g/mol. Its IUPAC name is 3-[4-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylcyclopentan-1-ol.
| Compound Name | 3-[4-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylcyclopentan-1-ol |
|---|---|
| PubChem CID | 123681188 |
| Molecular Formula | C26H24F7NO5S |
| Molecular Weight | 595.53 g/mol |
| Exact Mass | 595.13 |
| IUPAC Name | 3-[4-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylcyclopentan-1-ol |
| SMILES | Cc1noc(C)c1COC(c1ccc(C2(S(=O)(=O)c3ccc(F)cc3)CCC(O)C2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C26H24F7NO5S/c1-15-22(16(2)39-34-15)14-38-24(25(28,29)30,26(31,32)33)18-5-3-17(4-6-18)23(12-11-20(35)13-23)40(36,37)21-9-7-19(27)8-10-21/h3-10,20,35H,11-14H2,1-2H3 |
| InChIKey | SGQJMZBGGRMJBG-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.53 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |