C30H24F9NO4S — CID 118220881
1-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylcyclobutyl]pyrrolidin-2-one (PubChem CID 118220881) has the molecular formula C30H24F9NO4S and a molecular weight of 665.57 g/mol. Its IUPAC name is 1-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylcyclobutyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylcyclobutyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 118220881 |
| Molecular Formula | C30H24F9NO4S |
| Molecular Weight | 665.57 g/mol |
| Exact Mass | 665.13 |
| IUPAC Name | 1-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylcyclobutyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1C1CC(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C30H24F9NO4S/c31-20-10-12-22(13-11-20)45(42,43)27(15-21(16-27)40-14-2-5-26(40)41)18-6-8-19(9-7-18)28(29(34,35)36,30(37,38)39)44-17-23-24(32)3-1-4-25(23)33/h1,3-4,6-13,21H,2,5,14-17H2 |
| InChIKey | HICSUZCAHDPBOV-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.57 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |