C32H30F9NO4S — CID 175102548
4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonyl-1-(oxan-2-yl)piperidine (PubChem CID 175102548) has the molecular formula C32H30F9NO4S and a molecular weight of 695.64 g/mol. Its IUPAC name is 4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonyl-1-(oxan-2-yl)piperidine.
| Compound Name | 4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonyl-1-(oxan-2-yl)piperidine |
|---|---|
| PubChem CID | 175102548 |
| Molecular Formula | C32H30F9NO4S |
| Molecular Weight | 695.64 g/mol |
| Exact Mass | 695.18 |
| IUPAC Name | 4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonyl-1-(oxan-2-yl)piperidine |
| SMILES | O=S(=O)(c1ccc(F)cc1)C1(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)CCN(C2CCCCO2)CC1 |
| InChI | InChI=1S/C32H30F9NO4S/c33-23-11-13-24(14-12-23)47(43,44)29(15-17-42(18-16-29)28-6-1-2-19-45-28)21-7-9-22(10-8-21)30(31(36,37)38,32(39,40)41)46-20-25-26(34)4-3-5-27(25)35/h3-5,7-14,28H,1-2,6,15-20H2 |
| InChIKey | DPOYDMTYRFFPQR-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.64 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |