C34H28F9NO3S — CID 118212160
N-benzyl-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylcyclopentan-1-amine (PubChem CID 118212160) has the molecular formula C34H28F9NO3S and a molecular weight of 701.65 g/mol. Its IUPAC name is N-benzyl-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylcyclopentan-1-amine.
| Compound Name | N-benzyl-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylcyclopentan-1-amine |
|---|---|
| PubChem CID | 118212160 |
| Molecular Formula | C34H28F9NO3S |
| Molecular Weight | 701.65 g/mol |
| Exact Mass | 701.16 |
| IUPAC Name | N-benzyl-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylcyclopentan-1-amine |
| SMILES | O=S(=O)(c1ccc(F)cc1)C1(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)CCC(NCc2ccccc2)C1 |
| InChI | InChI=1S/C34H28F9NO3S/c35-25-13-15-27(16-14-25)48(45,46)31(18-17-26(19-31)44-20-22-5-2-1-3-6-22)23-9-11-24(12-10-23)32(33(38,39)40,34(41,42)43)47-21-28-29(36)7-4-8-30(28)37/h1-16,26,44H,17-21H2 |
| InChIKey | ZLBHUYIQHJBHNH-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.65 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |