C32H24F9NO4S2 — CID 162108216
1-[6-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-6-(4-fluorophenyl)sulfonyl-5,7-dihydro-4H-1,3-benzothiazol-2-yl]propan-2-one (PubChem CID 162108216) has the molecular formula C32H24F9NO4S2 and a molecular weight of 721.66 g/mol. Its IUPAC name is 1-[6-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-6-(4-fluorophenyl)sulfonyl-5,7-dihydro-4H-1,3-benzothiazol-2-yl]propan-2-one.
| Compound Name | 1-[6-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-6-(4-fluorophenyl)sulfonyl-5,7-dihydro-4H-1,3-benzothiazol-2-yl]propan-2-one |
|---|---|
| PubChem CID | 162108216 |
| Molecular Formula | C32H24F9NO4S2 |
| Molecular Weight | 721.66 g/mol |
| Exact Mass | 721.10 |
| IUPAC Name | 1-[6-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-6-(4-fluorophenyl)sulfonyl-5,7-dihydro-4H-1,3-benzothiazol-2-yl]propan-2-one |
| SMILES | CC(=O)Cc1nc2c(s1)CC(c1ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc1)(S(=O)(=O)c1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C32H24F9NO4S2/c1-18(43)15-28-42-26-13-14-29(16-27(26)47-28,48(44,45)22-11-9-21(33)10-12-22)19-5-7-20(8-6-19)30(31(36,37)38,32(39,40)41)46-17-23-24(34)3-2-4-25(23)35/h2-12H,13-17H2,1H3 |
| InChIKey | ZFUGADLUUBHNHJ-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.66 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |