C19H16ClF8NO2S — CID 122669304
3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]cyclobutan-1-amine;hydrochloride (PubChem CID 122669304) has the molecular formula C19H16ClF8NO2S and a molecular weight of 509.85 g/mol. Its IUPAC name is 3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]cyclobutan-1-amine;hydrochloride.
| Compound Name | 3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]cyclobutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 122669304 |
| Molecular Formula | C19H16ClF8NO2S |
| Molecular Weight | 509.85 g/mol |
| Exact Mass | 509.05 |
| IUPAC Name | 3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]cyclobutan-1-amine;hydrochloride |
| SMILES | Cl.NC1CC(c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H15F8NO2S.ClH/c20-13-5-7-15(8-6-13)31(29,30)16(9-14(28)10-16)11-1-3-12(4-2-11)17(21,18(22,23)24)19(25,26)27;/h1-8,14H,9-10,28H2;1H |
| InChIKey | INCLCBOKNNTFIV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.85 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |