C26H22F8N2O4S2 — CID 118218925
N-[4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]cyclohexyl]pyridine-3-sulfonamide (PubChem CID 118218925) has the molecular formula C26H22F8N2O4S2 and a molecular weight of 642.59 g/mol. Its IUPAC name is N-[4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]cyclohexyl]pyridine-3-sulfonamide.
| Compound Name | N-[4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]cyclohexyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 118218925 |
| Molecular Formula | C26H22F8N2O4S2 |
| Molecular Weight | 642.59 g/mol |
| Exact Mass | 642.09 |
| IUPAC Name | N-[4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]cyclohexyl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NC1CCC(c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)CC1)c1cccnc1 |
| InChI | InChI=1S/C26H22F8N2O4S2/c27-19-7-9-21(10-8-19)41(37,38)23(13-11-20(12-14-23)36-42(39,40)22-2-1-15-35-16-22)17-3-5-18(6-4-17)24(28,25(29,30)31)26(32,33)34/h1-10,15-16,20,36H,11-14H2 |
| InChIKey | SNHDEMQNQQHDFG-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.59 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |