C21H18F8O2S — CID 144882080
1-[(1S,3R)-1-(4-fluorophenyl)sulfonyl-3-methylcyclopentyl]-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene (PubChem CID 144882080) has the molecular formula C21H18F8O2S and a molecular weight of 486.42 g/mol. Its IUPAC name is 1-[(1S,3R)-1-(4-fluorophenyl)sulfonyl-3-methylcyclopentyl]-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene.
| Compound Name | 1-[(1S,3R)-1-(4-fluorophenyl)sulfonyl-3-methylcyclopentyl]-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene |
|---|---|
| PubChem CID | 144882080 |
| Molecular Formula | C21H18F8O2S |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | 1-[(1S,3R)-1-(4-fluorophenyl)sulfonyl-3-methylcyclopentyl]-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene |
| SMILES | C[C@@H]1CC[C@](c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H18F8O2S/c1-13-10-11-18(12-13,32(30,31)17-8-6-16(22)7-9-17)14-2-4-15(5-3-14)19(23,20(24,25)26)21(27,28)29/h2-9,13H,10-12H2,1H3/t13-,18+/m1/s1 |
| InChIKey | LISLMHXEPFCSSY-ACJLOTCBSA-N |
| XLogP | 6.60 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |