C30H29F8N3O4S — CID 118218910
1-(2-cyanoacetyl)-N-[4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]cyclohexyl]piperidine-4-carboxamide (PubChem CID 118218910) has the molecular formula C30H29F8N3O4S and a molecular weight of 679.63 g/mol. Its IUPAC name is 1-(2-cyanoacetyl)-N-[4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]cyclohexyl]piperidine-4-carboxamide.
| Compound Name | 1-(2-cyanoacetyl)-N-[4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]cyclohexyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 118218910 |
| Molecular Formula | C30H29F8N3O4S |
| Molecular Weight | 679.63 g/mol |
| Exact Mass | 679.18 |
| IUPAC Name | 1-(2-cyanoacetyl)-N-[4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]cyclohexyl]piperidine-4-carboxamide |
| SMILES | N#CCC(=O)N1CCC(C(=O)NC2CCC(c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C30H29F8N3O4S/c31-22-5-7-24(8-6-22)46(44,45)27(20-1-3-21(4-2-20)28(32,29(33,34)35)30(36,37)38)14-9-23(10-15-27)40-26(43)19-12-17-41(18-13-19)25(42)11-16-39/h1-8,19,23H,9-15,17-18H2,(H,40,43) |
| InChIKey | YNNKUFHXQPPQOJ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.63 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |